| Compound Information | SONAR Target prediction | | Name: | Bacampicillin hydrochloride | | Unique Identifier: | Prest776 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C21ClH28N3O7S | | Molecular Weight: | 475.775 g/mol | | X log p: | 9.319 (online calculus) | | Lipinksi Failures | 2 | | TPSA | 124.51 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 10 | | Rotatable Bond Count: | 11 | | Canonical Smiles: | Cl.CCOC(=O)OC(C)OC(=O)C1N2C(SC1(C)C)C(NC(=O)C(N)c1ccccc1)C2=O |
| Species: |
9606 |
| Condition: |
TMPPre001 |
| Replicates: |
2 |
| Raw OD Value: r im |
2139.0000±0 |
| Normalized OD Score: sc h |
1.0306±0 |
| Z-Score: |
0.6900±0 |
| p-Value: |
0.490172 |
| Z-Factor: |
-6.18056 |
| Fitness Defect: |
0.713 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 6|B7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 24.00 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 1009.5±953.84240 | | Plate DMSO Control (-): | 2021±558.06298 | | Plate Z-Factor: | -4.4864 |
|  png
ps
pdf |
| 5702218 |
1-ethoxycarbonyloxyethyl
6-[[(2R)-2-amino-2-phenyl-acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxyla
te hydrochloride |
| 5702219 |
1-ethoxycarbonyloxyethyl
6-[[(2R)-2-amino-2-phenyl-acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxyla
te |
| 6604397 |
[(1S)-1-ethoxycarbonyloxyethyl]
(2S,5R,6R)-6-[[(2S)-2-amino-2-phenyl-acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-
2-carboxylate |
| internal high similarity DBLink | Rows returned: 0 | |
|
