| Compound Information | SONAR Target prediction | | Name: | Glycocholic acid | | Unique Identifier: | Prest768 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C26H43NO6 | | Molecular Weight: | 426.313 g/mol | | X log p: | -1.652 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 34.14 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | CC(CCC(=O)NCC(O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C | | Generic_name: | GLYCOCHENODEOXYCHOLIC ACID | | Chemical_iupac_name: | GLYCOCHENODEOXYCHOLIC ACID | | Drug_type: | Experimental | | Drugbank_id: | EXPT00909 | | Logp: | 3.7 | | Drug_category: | 7 Alpha-Hydroxysteroid Dehydrogenase inhibitor | | Organisms_affected: | -1 |
| Species: |
9606 |
| Condition: |
TMPPre003 |
| Replicates: |
2 |
| Raw OD Value: r im |
18675.0000±0 |
| Normalized OD Score: sc h |
1.0211±0 |
| Z-Score: |
0.5873±0 |
| p-Value: |
0.556976 |
| Z-Factor: |
-5.58155 |
| Fitness Defect: |
0.5852 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 7|E2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 24.10 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 18050±2247.77104 | | Plate DMSO Control (-): | 18225±2038.51752 | | Plate Z-Factor: | -32.1903 |
| png ps pdf |
| 755 |
2-[4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a] phenanthren-17-yl)pentanoylamino]acetic acid |
| 10140 |
2-[[(4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12, 14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]acetic acid |
| 12544 |
2-[[(4R)-4-[(3R,5S,7R,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16 ,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]acetic acid |
| 13341 |
sodium 2-[4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a] phenanthren-17-yl)pentanoylamino]acetate |
| 27928 |
sodium 2-[4-(3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phen anthren-17-yl)pentanoylamino]acetate |
| 27929 |
2-[4-(3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phen anthren-17-yl)pentanoylamino]acetic acid |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 10691 | Additional Members: 8 | Rows returned: 0 | |
|