| Compound Information | SONAR Target prediction | | Name: | Clenbuterol hydrochloride | | Unique Identifier: | Prest761 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C12Cl3H19N2O | | Molecular Weight: | 294.499 g/mol | | X log p: | 4.219 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | Cl.CC(C)(C)NCC(O)c1cc(Cl)c(N)c(Cl)c1 |
| Species: |
9606 |
| Condition: |
TMPPre003 |
| Replicates: |
2 |
| Raw OD Value: r im |
18085.0000±0 |
| Normalized OD Score: sc h |
0.9847±0 |
| Z-Score: |
-0.4264±0 |
| p-Value: |
0.66983 |
| Z-Factor: |
-13.5768 |
| Fitness Defect: |
0.4007 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 5|C6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.80 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 18290±2002.70234 | | Plate DMSO Control (-): | 18264.5±1013.26960 | | Plate Z-Factor: | -63.2184 |
|  png
ps
pdf |
| 5702273 |
1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol hydrochloride |
| 6921737 |
[(2R)-2-(4-amino-3,5-dichloro-phenyl)-2-hydroxy-ethyl]-tert-butyl-azanium |
| 6921738 |
[(2S)-2-(4-amino-3,5-dichloro-phenyl)-2-hydroxy-ethyl]-tert-butyl-azanium |
| 16048573 |
(1S)-1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol hydrochloride |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 17428 | Additional Members: 9 | Rows returned: 0 | |
|
