Compound Information | SONAR Target prediction | Name: | Clenbuterol hydrochloride | Unique Identifier: | Prest761 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C12Cl3H19N2O | Molecular Weight: | 294.499 g/mol | X log p: | 4.219 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 4 | Canonical Smiles: | Cl.CC(C)(C)NCC(O)c1cc(Cl)c(N)c(Cl)c1 |
Species: |
9606 |
Condition: |
TMPPre002 |
Replicates: |
2 |
Raw OD Value: r im |
10040.5000±0 |
Normalized OD Score: sc h |
0.9744±0 |
Z-Score: |
-0.5776±0 |
p-Value: |
0.563546 |
Z-Factor: |
-9.53708 |
Fitness Defect: |
0.5735 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 5|C6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.80 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 967.5±954.39230 | Plate DMSO Control (-): | 2031±542.13094 | Plate Z-Factor: | -4.5046 |
| png ps pdf |
5702273 |
1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol hydrochloride |
6921737 |
[(2R)-2-(4-amino-3,5-dichloro-phenyl)-2-hydroxy-ethyl]-tert-butyl-azanium |
6921738 |
[(2S)-2-(4-amino-3,5-dichloro-phenyl)-2-hydroxy-ethyl]-tert-butyl-azanium |
16048573 |
(1S)-1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol hydrochloride |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 17428 | Additional Members: 9 | Rows returned: 0 | |
|