| Compound Information | SONAR Target prediction |  | Name: | Anisomycin |  | Unique Identifier: | Prest720  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C14H19NO4 |  | Molecular Weight: | 246.154 g/mol |  | X log p: | 8.199  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 35.53 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 5 |  | Canonical Smiles: | COc1ccc(CC2NCC(O)C2OC(C)=O)cc1 |  
 
 
	
		| Species: | 
		9606 | 
	 
	
		| Condition: | 
		TMPPre001 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		2163.0000±0 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0143±0 | 
	 
	
		| Z-Score: | 
		0.3224±0 | 
	 
	
		| p-Value: | 
		0.74718 | 
	 
	
		| Z-Factor: | 
		-7.36303 | 
	 
	
		| Fitness Defect: | 
		0.2914 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Prestwick |  | Plate Number and Position: | 6|B3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 0 nm |  | Robot Temperature: | 24.00 Celcius |  | Date: | 2006-10-10 YYYY-MM-DD |  | Plate CH Control (+): | 1009.5±953.84240 |  | Plate DMSO Control (-): | 2021±558.06298 |  | Plate Z-Factor: | -4.4864 |  
  |  png ps pdf |  
 
 
	
		| 7059484 | 
		[(2S,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]-2,3,4,5-tetrahydropyrrol-3-yl] acetate | 
	 
	
		| 7059485 | 
		[(2S,3R,4S)-4-hydroxy-2-[(4-methoxyphenyl)methyl]-2,3,4,5-tetrahydropyrrol-3-yl] acetate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  nonactive | Cluster 6951 | Additional Members: 3 | Rows returned: 1 |  |   
 
 |