Compound Information | SONAR Target prediction | Name: | Anisomycin | Unique Identifier: | Prest720 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C14H19NO4 | Molecular Weight: | 246.154 g/mol | X log p: | 8.199 (online calculus) | Lipinksi Failures | 1 | TPSA | 35.53 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 5 | Canonical Smiles: | COc1ccc(CC2NCC(O)C2OC(C)=O)cc1 |
Species: |
9606 |
Condition: |
TMPPre003 |
Replicates: |
2 |
Raw OD Value: r im |
18385.0000±0 |
Normalized OD Score: sc h |
0.9896±0 |
Z-Score: |
-0.2902±0 |
p-Value: |
0.771684 |
Z-Factor: |
-22.6004 |
Fitness Defect: |
0.2592 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 6|B3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 24.00 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 18603±2417.22394 | Plate DMSO Control (-): | 18347.5±2353.75180 | Plate Z-Factor: | -21.3877 |
| png ps pdf |
6326612 |
[(2S,3S,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
6553911 |
[(2S,3S,4S)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
6604369 |
[(2S,3R,4S)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
6604848 |
[(2R,3R,4S)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
6918937 |
[(2S,3S,4S)-4-hydroxy-2-[(4-methoxyphenyl)methyl]-2,3,4,5-tetrahydropyrrol-3-yl] acetate |
7059483 |
[(2S,3S,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]-2,3,4,5-tetrahydropyrrol-3-yl] acetate |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 6951 | Additional Members: 3 | Rows returned: 1 | |
|