| Compound Information | SONAR Target prediction | | Name: | Anisomycin | | Unique Identifier: | Prest720 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C14H19NO4 | | Molecular Weight: | 246.154 g/mol | | X log p: | 8.199 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 35.53 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | COc1ccc(CC2NCC(O)C2OC(C)=O)cc1 |
| Species: |
9606 |
| Condition: |
TMPPre001 |
| Replicates: |
2 |
| Raw OD Value: r im |
2163.0000±0 |
| Normalized OD Score: sc h |
1.0143±0 |
| Z-Score: |
0.3224±0 |
| p-Value: |
0.74718 |
| Z-Factor: |
-7.36303 |
| Fitness Defect: |
0.2914 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 6|B3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 24.00 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 1009.5±953.84240 | | Plate DMSO Control (-): | 2021±558.06298 | | Plate Z-Factor: | -4.4864 |
|  png
ps
pdf |
| 2199 |
[4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
| 31549 |
[(2S,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
| 253602 |
[(2R,3S,4S)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
| 462385 |
[(2S,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate hydrochloride |
| 1268331 |
[(2R,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
| 5458313 |
[(2S,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate chloride |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 6951 | Additional Members: 3 | Rows returned: 1 | |
|
