Compound Information | SONAR Target prediction | Name: | Benzbromarone | Unique Identifier: | Prest709 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | Br2C17H12O3 | Molecular Weight: | 411.988 g/mol | X log p: | 14.302 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 3 | Canonical Smiles: | CCc1oc2ccccc2c1C(=O)c1cc(Br)c(O)c(Br)c1 |
Species: |
9606 |
Condition: |
TMPPre002 |
Replicates: |
2 |
Raw OD Value: r im |
8988.0000±0 |
Normalized OD Score: sc h |
0.8513±0 |
Z-Score: |
-3.3526±0 |
p-Value: |
0.000800502 |
Z-Factor: |
-15.9951 |
Fitness Defect: |
7.1303 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 5|E11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.80 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 967.5±954.39230 | Plate DMSO Control (-): | 2031±542.13094 | Plate Z-Factor: | -4.5046 |
| png ps pdf |
DBLink | Rows returned: 1 | |
2333 |
(3,5-dibromo-4-hydroxy-phenyl)-(2-ethylbenzofuran-3-yl)methanone |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 5540 | Additional Members: 5 | Rows returned: 4 | |
|