| Compound Information | SONAR Target prediction | | Name: | Benzbromarone | | Unique Identifier: | Prest709 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | Br2C17H12O3 | | Molecular Weight: | 411.988 g/mol | | X log p: | 14.302 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CCc1oc2ccccc2c1C(=O)c1cc(Br)c(O)c(Br)c1 |
| Species: |
9606 |
| Condition: |
TMPPre002 |
| Replicates: |
2 |
| Raw OD Value: r im |
8988.0000±0 |
| Normalized OD Score: sc h |
0.8513±0 |
| Z-Score: |
-3.3526±0 |
| p-Value: |
0.000800502 |
| Z-Factor: |
-15.9951 |
| Fitness Defect: |
7.1303 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 5|E11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.80 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 967.5±954.39230 | | Plate DMSO Control (-): | 2031±542.13094 | | Plate Z-Factor: | -4.5046 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 2333 |
(3,5-dibromo-4-hydroxy-phenyl)-(2-ethylbenzofuran-3-yl)methanone |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 5540 | Additional Members: 5 | Rows returned: 4 | |
|
