| Compound Information | SONAR Target prediction |
| Name: | Chlorpropamide |
| Unique Identifier: | Prest684 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C10ClH13N2O3S |
| Molecular Weight: | 263.637 g/mol |
| X log p: | 7.851 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 59.59 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 6 |
| Canonical Smiles: | CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 |
| Generic_name: | Chlorpropamide |
| Chemical_iupac_name: | N-(4-chlorophenyl)sulfonylmethanamide |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA448966 |
| Kegg_compound_id: | C06907 |
| Drugbank_id: | APRD00029 |
| Melting_point: | 127 - 129 oC |
| H2o_solubility: | Solubility at pH 6 is 2.2 mg/ml |
| Logp: | 2.653 |
| Cas_registry_number: | 94-20-2 |
| Mass_spectrum: | http://webbook.nist.gov/cgi/cbook.cgi?Spec=C94202&Index=0&Type=Mass&Large=on |
| Drug_category: | Hypoglycemic Agents; Sulfonylureas; ATC:A10BB02 |
| Indication: | For managing hyperglycemia in Non-insulin-dependent diabetes mellitus (NIDDM). |
| Pharmacology: | Chlorpropamide, a second-generation sulfonylurea antidiabetic agent, is used with diet to lower blood glucose levels in patients with diabetes mellitus type II. Chlorpropamide is twice as potent as the related second-generation agent glipizide. |
| Mechanism_of_action: | Sulfonylureas such as Chlorpropamide likely bind to ATP-sensitive potassium-channel receptors on the pancreatic cell surface, reducing potassium conductance and causing depolarization of the membrane. Depolarization stimulates calcium ion influx through voltage-sensitive calcium channels, raising intracellular concentrations of calcium ions, which induces the secretion, or exocytosis, of insulin. |
| Organisms_affected: | Humans and other mammals |