| Compound Information | SONAR Target prediction |
| Name: | Bupropion hydrochloride |
| Unique Identifier: | Prest668 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C13Cl2H19NO |
| Molecular Weight: | 257.051 g/mol |
| X log p: | 8.326 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 17.07 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 2 |
| Rotatable Bond Count: | 4 |
| Canonical Smiles: | Cl.CC(NC(C)(C)C)C(=O)c1cccc(Cl)c1 |
| Generic_name: | Bupropion |
| Chemical_iupac_name: | 1-(3-chlorophenyl)-2-tert-butylamino-propan-1-one |
| Drug_type: | Approved Drug |
| Kegg_compound_id: | C06860 |
| Drugbank_id: | APRD00621 |
| Melting_point: | 233-234oC |
| H2o_solubility: | 312 mg/ml |
| Logp: | 3.741 |
| Cas_registry_number: | 34841-39-9 |
| Drug_category: | Antidepressants; ATC:N07BA02 |
| Indication: | For the treatment of depression and as aid to smoking cessation. |
| Pharmacology: | Bupropion, an antidepressant of the aminoketone class and a non-nicotine aid to smoking cessation, is chemically unrelated to tricyclic, tetracyclic, selective serotonin re-uptake inhibitor, or other known antidepressant agents. Compared to classical tricyclic antidepressants, Bupropion is a relatively weak inhibitor of the neuronal uptake of norepinephrine, serotonin, and dopamine. In addition, Bupropion does not inhibit monoamine oxidase. Bupropion produces dose-related central nervous system (CNS) stimulant effects in animals, as evidenced by increased locomotor activity, increased rates of responding in various schedule-controlled operant behavior tasks, and, at high doses, induction of mild stereotyped behavior. |
| Mechanism_of_action: | Bupropion selectively inhibits the neuronal reuptake of dopamine, norepinephrine, and serotonin; actions on dopaminergic systems are more significant than imipramine or amitriptyline whereas the blockade of norepinephrine and serotonin reuptake at the neuronal membrane is weaker for bupropion than for tricyclic antidepressants. The increase in norepinephrine may attenuate nicotine withdrawal symptoms and the increase in dopamine at neuronal sites may reduce nicotine cravings and the urge to smoke. Bupropion exhibits moderate anticholinergic effects. |
| Organisms_affected: | Humans and other mammals |