Compound Information | SONAR Target prediction |
Name: | Methoxy-8-psoralen |
Unique Identifier: | Prest661 |
MolClass: | Checkout models in ver1.5 and ver1.0 |
Molecular Formula: | C12H8O4 |
Molecular Weight: | 208.126 g/mol |
X log p: | 11.189 (online calculus) |
Lipinksi Failures | 1 |
TPSA | 44.76 |
Hydrogen Bond Donor Count: | 0 |
Hydrogen Bond Acceptors Count: | 4 |
Rotatable Bond Count: | 1 |
Canonical Smiles: | COc1c2occc2cc2C=CC(=O)Oc21 |
Generic_name: | Methoxsalen |
Drug_type: | Approved Drug |
Kegg_compound_id: | C01864 |
Drugbank_id: | APRD00157 |
Logp: | 2.336 |
Cas_registry_number: | 298-81-7 |
Mass_spectrum: | http://webbook.nist.gov/cgi/cbook.cgi?Spec=C298817&Index=0&Type=Mass&Large=on |
Drug_category: | Antineoplastic Agents; Pigmenting Agents; ATC:D05AD02; ATC:D05BA02 |
Indication: | For the treatment of psoriasis and vitiligo |
Pharmacology: | Methoxsalen selectively inhibits the synthesis of deoxyribonucleic acid (DNA). The guanine and cytosine content correlates with the degree of Methoxsalen-induced cross-linking. At high concentrations of the drug, cellular RNA and protein synthesis are also suppressed. |
Mechanism_of_action: | After activation it binds preferentially to the guanine and cytosine moieties of DNA, leading to cross-linking of DNA, thus inhibiting DNA synthesis and function. |
Organisms_affected: | Humans and other mammals |