Compound Information | SONAR Target prediction | Name: | Troleandomycin | Unique Identifier: | Prest594 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C41H67NO15 | Molecular Weight: | 746.436 g/mol | X log p: | -0.425 (online calculus) | Lipinksi Failures | 2 | TPSA | 184.19 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 16 | Rotatable Bond Count: | 12 | Canonical Smiles: | COC1CC(OC(C)C1OC(C)=O)OC1C(C)C(OC2OC(C)CC(C2OC(C)=O)N(C)C)C(C)CC2(CO2) C(=O)C(C)C(OC(C)=O)C(C)C(C)OC(=O)C1C |
Species: |
9606 |
Condition: |
TMPPre003 |
Replicates: |
2 |
Raw OD Value: r im |
17204.0000±0 |
Normalized OD Score: sc h |
0.9586±0 |
Z-Score: |
-1.1522±0 |
p-Value: |
0.24923 |
Z-Factor: |
-2.93911 |
Fitness Defect: |
1.3894 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 1|D7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.50 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 18471.5±2737.44289 | Plate DMSO Control (-): | 18271±1230.24317 | Plate Z-Factor: | -192.4333 |
| png ps pdf |
17675 |
[(2S,3S,4S,6S)-6-[[(3R,5S,6S,7R,8S,9R,12R,13S,14R,15R)-14-acetyloxy-6-[(2S,3R,4S,6R)-3-acetyloxy-4-dimet hylamino-6-methyl-oxan-2-yl]oxy-5,7,9,12,13,15-hexamethyl-10,16-dioxo-1,11-dioxaspiro[2.13]hexadec-8-yl] oxy]-4-methoxy-2-methyl-oxan-3-yl] acetate |
202225 |
[(2S,3S,4S,6S)-6-[[(3R,5S,6S,7R,8S,9R,12R,13S,14S,15R)-14-acetyloxy-6-[(2S,3R,4S,6R)-3-acetyloxy-4-dimet hylamino-6-methyl-oxan-2-yl]oxy-5,7,9,12,13,15-hexamethyl-10,16-dioxo-1,11-dioxaspiro[2.13]hexadec-8-yl] oxy]-4-methoxy-2-methyl-oxan-3-yl] acetate |
418931 |
[6-[[14-acetyloxy-6-(3-acetyloxy-4-dimethylamino-6-methyl-oxan-2-yl)oxy-5,7,9,12,13,15-hexamethyl-10,16- dioxo-1,11-dioxaspiro[2.13]hexadec-8-yl]oxy]-4-methoxy-2-methyl-oxan-3-yl] acetate |
5284630 |
[(2S,3S,4S,6S)-6-[[(3S,5S,6S,7R,8S,9R,12R,13S,14S,15R)-14-acetyloxy-6-[(2S,3R,4S,6R)-3-acetyloxy-4-dimet hylamino-6-methyl-oxan-2-yl]oxy-5,7,9,12,13,15-hexamethyl-10,16-dioxo-1,11-dioxaspiro[2.13]hexadec-8-yl] oxy]-4-methoxy-2-methyl-oxan-3-yl] acetate |
5289436 |
[(2S,3S,4S,6S)-6-[[(3R,5R,6S,7R,8S,9R,12R,13S,14R,15R)-14-acetyloxy-6-[(2S,3R,4S,6R)-3-acetyloxy-4-dimet hylamino-6-methyl-oxan-2-yl]oxy-5,7,9,12,13,15-hexamethyl-10,16-dioxo-1,11-dioxaspiro[2.13]hexadec-8-yl] oxy]-4-methoxy-2-methyl-oxan-3-yl] acetate |
6540754 |
[(2S,3S,4S)-6-[[(3R,5S,6S,7R,8S,9R,12R,13S,14S,15R)-14-acetyloxy-6-[(3R,4S,6R)-3-acetyloxy-4-dimethylami no-6-methyl-oxan-2-yl]oxy-5,7,9,12,13,15-hexamethyl-10,16-dioxo-1,11-dioxaspiro[2.13]hexadec-8-yl]oxy]-4 -methoxy-2-methyl-oxan-3-yl] acetate |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 2234 | Additional Members: 5 | Rows returned: 0 | |
|