| Compound Information | SONAR Target prediction | | Name: | Chenodiol | | Unique Identifier: | Prest553 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C24H40O4 | | Molecular Weight: | 356.286 g/mol | | X log p: | -0.382 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(CCC(O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CCC12C | | Generic_name: | CHOLIC ACID | | Chemical_iupac_name: | CHOLIC ACID | | Drug_type: | Experimental | | Kegg_compound_id: | C00695 | | Drugbank_id: | EXPT00906 | | Logp: | 2.818 | | Cas_registry_number: | 81-25-4 | | Drug_category: | Estrogen-Related Receptor Gamma inhibitor | | Organisms_affected: | -1 |
| Species: |
9606 |
| Condition: |
TMPPre003 |
| Replicates: |
2 |
| Raw OD Value: r im |
18124.0000±0 |
| Normalized OD Score: sc h |
1.0098±0 |
| Z-Score: |
0.2714±0 |
| p-Value: |
0.786106 |
| Z-Factor: |
-11.9639 |
| Fitness Defect: |
0.2407 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 4|E6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.70 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 18451.5±2414.05033 | | Plate DMSO Control (-): | 18390±2336.55654 | | Plate Z-Factor: | -30.8248 |
|  png
ps
pdf |
| 376831 |
4-[(5S,8S,10R,13R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-
cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 376832 |
4-[(5S,7S,8S,10R,13R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-
1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 376836 |
4-[(5S,7S,8S,10R,13R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-
1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-pentanoic acid |
| 388708 |
(4R)-4-[(3R,5S,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tet
radecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 439520 |
4-[(3R,5S,7R,12S)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-c
yclopenta[a]phenanthren-17-yl]pentanoic acid |
| 440384 |
(6R)-6-[(3R,5S,7R,10R,13R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro
-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-heptanoic acid |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 2228 | Additional Members: 18 | Rows returned: 7 | 1 2 Next >> |
|
