Compound Information | SONAR Target prediction | Name: | Naringenine | Unique Identifier: | Prest531 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H12O5 | Molecular Weight: | 260.158 g/mol | X log p: | 12.698 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1ccc(cc1)C1CC(=O)c2c(O)cc(O)cc2O1 | Generic_name: | NARINGENIN | Chemical_iupac_name: | NARINGENIN | Drug_type: | Experimental | Kegg_compound_id: | C00509 | Drugbank_id: | EXPT02295 | Logp: | 2.211 | Cas_registry_number: | 480-41-1 | Drug_category: | Chalcone-Flavonone Isomerase 1 inhibitor | Organisms_affected: | -1 |
Species: |
9606 |
Condition: |
TMPPre002 |
Replicates: |
2 |
Raw OD Value: r im |
9433.5000±0 |
Normalized OD Score: sc h |
0.9522±0 |
Z-Score: |
-1.0780±0 |
p-Value: |
0.28105 |
Z-Factor: |
-21.4323 |
Fitness Defect: |
1.2692 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 6|G7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 24.00 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 1009.5±953.84240 | Plate DMSO Control (-): | 2021±558.06298 | Plate Z-Factor: | -4.4864 |
| png ps pdf |
DBLink | Rows returned: 3 | |
932 |
5,7-dihydroxy-2-(4-hydroxyphenyl)chroman-4-one |
439246 |
(2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)chroman-4-one |
667495 |
(2R)-5,7-dihydroxy-2-(4-hydroxyphenyl)chroman-4-one |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 14672 | Additional Members: 12 | Rows returned: 1 | |
|