| Compound Information | SONAR Target prediction | | Name: | Naringenine | | Unique Identifier: | Prest531 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H12O5 | | Molecular Weight: | 260.158 g/mol | | X log p: | 12.698 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1ccc(cc1)C1CC(=O)c2c(O)cc(O)cc2O1 | | Generic_name: | NARINGENIN | | Chemical_iupac_name: | NARINGENIN | | Drug_type: | Experimental | | Kegg_compound_id: | C00509 | | Drugbank_id: | EXPT02295 | | Logp: | 2.211 | | Cas_registry_number: | 480-41-1 | | Drug_category: | Chalcone-Flavonone Isomerase 1 inhibitor | | Organisms_affected: | -1 |
| Species: |
9606 |
| Condition: |
TMPPre001 |
| Replicates: |
2 |
| Raw OD Value: r im |
1951.0000±0 |
| Normalized OD Score: sc h |
0.9522±0 |
| Z-Score: |
-1.0780±0 |
| p-Value: |
0.28105 |
| Z-Factor: |
-21.4323 |
| Fitness Defect: |
1.2692 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 6|G7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 24.00 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 1009.5±953.84240 | | Plate DMSO Control (-): | 2021±558.06298 | | Plate Z-Factor: | -4.4864 |
|  png
ps
pdf |
| DBLink | Rows returned: 3 | |
| 932 |
5,7-dihydroxy-2-(4-hydroxyphenyl)chroman-4-one |
| 439246 |
(2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)chroman-4-one |
| 667495 |
(2R)-5,7-dihydroxy-2-(4-hydroxyphenyl)chroman-4-one |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 14672 | Additional Members: 12 | Rows returned: 1 | |
|
