Compound Information | SONAR Target prediction | Name: | Acacetin | Unique Identifier: | Prest49 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C16H12O5 | Molecular Weight: | 272.168 g/mol | X log p: | 15.05 (online calculus) | Lipinksi Failures | 1 | TPSA | 35.53 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 2 | Canonical Smiles: | COc1ccc(cc1)C1Oc2cc(O)cc(O)c2C(=O)C=1 |
Species: |
9606 |
Condition: |
TMPPre003 |
Replicates: |
2 |
Raw OD Value: r im |
17498.0000±0 |
Normalized OD Score: sc h |
0.9842±0 |
Z-Score: |
-0.4388±0 |
p-Value: |
0.660828 |
Z-Factor: |
-16.7102 |
Fitness Defect: |
0.4143 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 9|F6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 24.30 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 17809.5±2259.84799 | Plate DMSO Control (-): | 17786.5±3564.04555 | Plate Z-Factor: | -19.1868 |
| png ps pdf |
DBLink | Rows returned: 1 | |
5280442 |
5,7-dihydroxy-2-(4-methoxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 0 | |
|