| Compound Information | SONAR Target prediction | | Name: | Piperine | | Unique Identifier: | Prest398 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17H19NO3 | | Molecular Weight: | 266.187 g/mol | | X log p: | 14.992 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 38.77 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | O=C(C=CC=Cc1ccc2OCOc2c1)N1CCCCC1 |
| Species: |
9606 |
| Condition: |
TMPPre003 |
| Replicates: |
2 |
| Raw OD Value: r im |
12435.0000±0 |
| Normalized OD Score: sc h |
0.6813±0 |
| Z-Score: |
-8.8649±0 |
| p-Value: |
7.6584e-19 |
| Z-Factor: |
-0.318411 |
| Fitness Defect: |
41.7133 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 6|H5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 24.00 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 18603±2417.22394 | | Plate DMSO Control (-): | 18347.5±2353.75180 | | Plate Z-Factor: | -21.3877 |
|  png
ps
pdf |
| DBLink | Rows returned: 4 | |
| 4840 |
5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
| 638024 |
(2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
| 1548912 |
(2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
| 1548913 |
(2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 14706 | Additional Members: 7 | Rows returned: 2 | |
|
