| Compound Information | SONAR Target prediction | | Name: | Ursolic acid | | Unique Identifier: | Prest355 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C30H48O3 | | Molecular Weight: | 411.343 g/mol | | X log p: | 1.228 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC1CCC2(CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C)C(O)=O |
| Species: |
9606 |
| Condition: |
TMPPre002 |
| Replicates: |
2 |
| Raw OD Value: r im |
10120.0000±0 |
| Normalized OD Score: sc h |
1.0325±0 |
| Z-Score: |
0.7321±0 |
| p-Value: |
0.464106 |
| Z-Factor: |
-5.47308 |
| Fitness Defect: |
0.7676 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 2|A10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.40 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 979±955.64442 | | Plate DMSO Control (-): | 1983.5±536.09994 | | Plate Z-Factor: | -4.7841 |
| png ps pdf |
| 6454401 |
(1S,2R,4aS,6aS,6aS,6bR,12aS,14bS)-1,2,6a,6b,9,9,12a-heptamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14 b-tetradecahydropicene-4a-carboxylic acid |
| 6476239 |
(E,8S)-2-butyl-10-hydroxy-4,8-dimethyl-dec-4-enoic acid |
| 6476240 |
(E,8S)-10-hydroxy-4,8-dimethyl-2-pentan-2-yl-dec-4-enoic acid |
| 6476241 |
(E,8S)-2-hexyl-10-hydroxy-4,8-dimethyl-dec-4-enoic acid |
| 6563072 |
(4aR,6aR,6aS,6bR,8aR,10S,12aR,14bR)-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,1 2,13,14b-tetradecahydropicene-4a-carboxylate |
| 6563073 |
(4aR,6aR,6aS,6bR,8aR,10S,12aR,14bR)-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,1 2,13,14b-tetradecahydropicene-4a-carboxylic acid |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 1869 | Additional Members: 9 | Rows returned: 4 | |
|