Compound Information | SONAR Target prediction | Name: | N6-methyladenosine | Unique Identifier: | Prest343 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C11H15N5O4 | Molecular Weight: | 266.149 g/mol | X log p: | 3.289 (online calculus) | Lipinksi Failures | 0 | TPSA | 49.55 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 9 | Rotatable Bond Count: | 3 | Canonical Smiles: | CNc1ncnc2n(cnc12)C1OC(CO)C(O)C1O |
Species: |
9606 |
Condition: |
TMPPre002 |
Replicates: |
2 |
Raw OD Value: r im |
9767.0000±0 |
Normalized OD Score: sc h |
0.9620±0 |
Z-Score: |
-0.8573±0 |
p-Value: |
0.391284 |
Z-Factor: |
-11.5935 |
Fitness Defect: |
0.9383 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 5|B9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.80 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 967.5±954.39230 | Plate DMSO Control (-): | 2031±542.13094 | Plate Z-Factor: | -4.5046 |
| png ps pdf |
DBLink | Rows returned: 4 | |
1869 |
2-(hydroxymethyl)-5-(6-methylaminopurin-9-yl)oxolane-3,4-diol |
101382 |
(2R,3R,4S,5R)-2-(hydroxymethyl)-5-(6-methylaminopurin-9-yl)oxolane-3,4-diol |
102175 |
(2R,3R,4R,5R)-2-(hydroxymethyl)-5-(6-methylaminopurin-9-yl)oxolane-3,4-diol |
5284425 |
(2S,3S,4S,5R)-2-(hydroxymethyl)-5-(6-methylaminopurin-9-yl)oxolane-3,4-diol |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 16028 | Additional Members: 4 | Rows returned: 3 | |
|