| 
 | Compound Information | SONAR Target prediction |  | Name: | Flumethasone |  | Unique Identifier: | Prest229 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C22F2H28O5 |  | Molecular Weight: | 384.245 g/mol |  | X log p: | 4.584  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 34.14 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | CC1CC2C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)CO | 
 
 
	
		| Species: | 9606 |  
		| Condition: | TMPPre003 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 14387.0000±0 |  
		| Normalized OD Score: sc h | 1.0491±0 |  
		| Z-Score: | 1.3669±0 |  
		| p-Value: | 0.171671 |  
		| Z-Factor: | -7.30263 |  
		| Fitness Defect: | 1.7622 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Prestwick |  | Plate Number and Position: | 10|B5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 0 nm |  | Robot Temperature: | 23.30 Celcius |  | Date: | 2006-10-10 YYYY-MM-DD |  | Plate CH Control (+): | 22161±7450.25778 |  | Plate DMSO Control (-): | 13194±7524.46004 |  | Plate Z-Factor: | -6.8985 | 
 |  png ps
 pdf
 | 
 
 
	
		| 3375 | 6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclo penta[a]phenanthren-3-one
 |  
		| 16490 | (6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl- 6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one
 |  
		| 71415 | (6S,8S,9R,10S,11S,13S,14S,16S,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl- 6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one
 |  
		| 101859 | (6S,8S,9R,10S,11S,13S,14S,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,11 ,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one
 |  
		| 494039 | 6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopent a[a]phenanthren-3-one
 |  
		| 5702178 | (6S,9R,10S,11S,13S,16R,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,1 1,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one
 |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 
 |