| Compound Information | SONAR Target prediction | | Name: | Flumethasone | | Unique Identifier: | Prest229 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C22F2H28O5 | | Molecular Weight: | 384.245 g/mol | | X log p: | 4.584 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 34.14 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC1CC2C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)CO |
| Species: |
9606 |
| Condition: |
TMPPre001 |
| Replicates: |
2 |
| Raw OD Value: r im |
1293.0000±0 |
| Normalized OD Score: sc h |
1.0713±0 |
| Z-Score: |
1.6075±0 |
| p-Value: |
0.10794 |
| Z-Factor: |
-12.6702 |
| Fitness Defect: |
2.2262 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 10|B5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.30 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 870.5±769.75857 | | Plate DMSO Control (-): | 982.5±305.13061 | | Plate Z-Factor: | -45.8313 |
| png ps pdf |
| 6454069 |
(6R,8S,10S,11S,13S,14S,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,11,12 ,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| 6454086 |
(6R,8S,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7 ,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| 6604306 |
(6S,8S,9S,10R,11R,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl- 6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| 6713129 |
(8R,9S,10R,11S,13S,14S,17S)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,11,12 ,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 9739 | Additional Members: 15 | Rows returned: 1 | |
|