| Compound Information | SONAR Target prediction |
| Name: | Fluphenazine dihydrochloride |
| Unique Identifier: | Prest225 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C22Cl2F3H28N3OS |
| Molecular Weight: | 482.222 g/mol |
| X log p: | 16.56 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 35.02 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 7 |
| Canonical Smiles: | Cl.Cl.OCCN1CCN(CCCN2c3ccccc3Sc3ccc(cc23)C(F)(F)F)CC1 |
| Generic_name: | Fluphenazine |
| Chemical_iupac_name: | 2-[4-[3-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propyl]piperazin-1-yl]ethanol |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA449676 |
| Drugbank_id: | APRD00633 |
| Melting_point: | < 25 oC |
| H2o_solubility: | 31.1 mg/L |
| Logp: | 4.552 |
| Isoelectric_point: | 7.9 |
| Cas_registry_number: | 69-23-8 |
| Drug_category: | Antipsychotics; Phenothiazines; ATC:N05AB02 |
| Indication: | For management of manifestations of psychotic disorders. |
| Pharmacology: | Fluphenazine is a trifluoro-methyl phenothiazine derivative intended for the management of schizophrenia and other psychotic disorders. Fluphenazine has not been shown effective in the management of behaviorial complications in patients with mental retardation. |
| Mechanism_of_action: | Fluphenazine blocks postsynaptic mesolimbic dopaminergic D1 and D2 receptors in the brain; depresses the release of hypothalamic and hypophyseal hormones and is believed to depress the reticular activating system thus affecting basal metabolism, body temperature, wakefulness, vasomotor tone, and emesis. |
| Organisms_affected: | Humans and other mammals |