| Compound Information | SONAR Target prediction | | Name: | Flunarizine dihydrochloride | | Unique Identifier: | Prest222 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C26Cl2F2H28N2 | | Molecular Weight: | 449.194 g/mol | | X log p: | 32.214 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 6.48 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | Cl.Cl.Fc1ccc(cc1)C(N1CCN(CC1)CC=Cc1ccccc1)c1ccc(F)cc1 |
| Species: |
9606 |
| Condition: |
TMPPre003 |
| Replicates: |
2 |
| Raw OD Value: r im |
17232.0000±0 |
| Normalized OD Score: sc h |
0.9402±0 |
| Z-Score: |
-1.6650±0 |
| p-Value: |
0.095918 |
| Z-Factor: |
-8.4817 |
| Fitness Defect: |
2.3443 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 4|H3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.70 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 18451.5±2414.05033 | | Plate DMSO Control (-): | 18390±2336.55654 | | Plate Z-Factor: | -30.8248 |
|  png
ps
pdf |
| 5353625 |
1-[bis(4-fluorophenyl)methyl]-4-cinnamyl-2,3,5,6-tetrahydropyrazine |
| 5388974 |
1-[bis(4-fluorophenyl)methyl]-4-cinnamyl-piperazine; hydrogen(+1) cation; chloride |
| 6365505 |
1-[bis(4-fluorophenyl)methyl]-4-cinnamyl-piperazine hydrochloride |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 3056 | Additional Members: 6 | Rows returned: 3 | |
|
