| 
 | Compound Information | SONAR Target prediction |  | Name: | Capsaicin |  | Unique Identifier: | Prest204 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C18H27NO3 |  | Molecular Weight: | 278.198 g/mol |  | X log p: | 10.788  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 10 |  | Canonical Smiles: | COc1cc(CNC(=O)CCCCC=CC(C)C)ccc1O | 
 
 
	
		| Species: | 9606 |  
		| Condition: | TMPPre002 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 6315.0000±0 |  
		| Normalized OD Score: sc h | 1.0453±0 |  
		| Z-Score: | 1.0202±0 |  
		| p-Value: | 0.307616 |  
		| Z-Factor: | -66.8942 |  
		| Fitness Defect: | 1.1789 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Prestwick |  | Plate Number and Position: | 11|H10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 0 nm |  | Robot Temperature: | 23.20 Celcius |  | Date: | 2006-10-10 YYYY-MM-DD |  | Plate CH Control (+): | 853.5±701.09504 |  | Plate DMSO Control (-): | 849±311.18603 |  | Plate Z-Factor: | -72.3031 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 4 |  | 
 
	
		| 2548 | N-[(4-hydroxy-3-methoxy-phenyl)methyl]-8-methyl-non-6-enamide |  
		| 1548942 | (E)-N-[(4-hydroxy-3-methoxy-phenyl)methyl]-8-methyl-non-6-enamide |  
		| 1548943 | (E)-N-[(4-hydroxy-3-methoxy-phenyl)methyl]-8-methyl-non-6-enamide |  
		| 6440227 | (E)-N-[(4-hydroxy-3-methoxy-phenyl)methyl]-2,8-dimethyl-non-6-enamide |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | active | Cluster 16111 | Additional Members: 9 | Rows returned: 1 |  | 
 
 |