Compound Information | SONAR Target prediction | Name: | Capsaicin | Unique Identifier: | Prest204 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C18H27NO3 | Molecular Weight: | 278.198 g/mol | X log p: | 10.788 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 10 | Canonical Smiles: | COc1cc(CNC(=O)CCCCC=CC(C)C)ccc1O |
Species: |
9606 |
Condition: |
TMPPre002 |
Replicates: |
2 |
Raw OD Value: r im |
6315.0000±0 |
Normalized OD Score: sc h |
1.0453±0 |
Z-Score: |
1.0202±0 |
p-Value: |
0.307616 |
Z-Factor: |
-66.8942 |
Fitness Defect: |
1.1789 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 11|H10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.20 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 853.5±701.09504 | Plate DMSO Control (-): | 849±311.18603 | Plate Z-Factor: | -72.3031 |
| png ps pdf |
DBLink | Rows returned: 4 | |
2548 |
N-[(4-hydroxy-3-methoxy-phenyl)methyl]-8-methyl-non-6-enamide |
1548942 |
(E)-N-[(4-hydroxy-3-methoxy-phenyl)methyl]-8-methyl-non-6-enamide |
1548943 |
(E)-N-[(4-hydroxy-3-methoxy-phenyl)methyl]-8-methyl-non-6-enamide |
6440227 |
(E)-N-[(4-hydroxy-3-methoxy-phenyl)methyl]-2,8-dimethyl-non-6-enamide |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 16111 | Additional Members: 9 | Rows returned: 1 | |
|