| Compound Information | SONAR Target prediction | | Name: | Capsaicin | | Unique Identifier: | Prest204 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C18H27NO3 | | Molecular Weight: | 278.198 g/mol | | X log p: | 10.788 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 10 | | Canonical Smiles: | COc1cc(CNC(=O)CCCCC=CC(C)C)ccc1O |
| Species: |
9606 |
| Condition: |
TMPPre001 |
| Replicates: |
2 |
| Raw OD Value: r im |
877.0000±0 |
| Normalized OD Score: sc h |
1.0453±0 |
| Z-Score: |
1.0202±0 |
| p-Value: |
0.307616 |
| Z-Factor: |
-66.8942 |
| Fitness Defect: |
1.1789 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 11|H10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.20 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 853.5±701.09504 | | Plate DMSO Control (-): | 849±311.18603 | | Plate Z-Factor: | -72.3031 |
|  png
ps
pdf |
| DBLink | Rows returned: 4 | |
| 2548 |
N-[(4-hydroxy-3-methoxy-phenyl)methyl]-8-methyl-non-6-enamide |
| 1548942 |
(E)-N-[(4-hydroxy-3-methoxy-phenyl)methyl]-8-methyl-non-6-enamide |
| 1548943 |
(E)-N-[(4-hydroxy-3-methoxy-phenyl)methyl]-8-methyl-non-6-enamide |
| 6440227 |
(E)-N-[(4-hydroxy-3-methoxy-phenyl)methyl]-2,8-dimethyl-non-6-enamide |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 16111 | Additional Members: 9 | Rows returned: 1 | |
|
