Compound Information | SONAR Target prediction | Name: | Dexamethasone acetate | Unique Identifier: | Prest157 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C24FH31O6 | Molecular Weight: | 405.267 g/mol | X log p: | 4.203 (online calculus) | Lipinksi Failures | 0 | TPSA | 60.44 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)COC(C)=O |
Species: |
9606 |
Condition: |
TMPPre001 |
Replicates: |
2 |
Raw OD Value: r im |
2048.0000±0 |
Normalized OD Score: sc h |
1.0002±0 |
Z-Score: |
0.0046±0 |
p-Value: |
0.996324 |
Z-Factor: |
-7.71986 |
Fitness Defect: |
0.0037 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 2|E11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.40 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 979±955.64442 | Plate DMSO Control (-): | 1983.5±536.09994 | Plate Z-Factor: | -4.7841 |
| png ps pdf |
3680 |
[2-(9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenant hren-17-yl)-2-oxo-ethyl] acetate |
9563 |
[2-[(9R,11S)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]ph enanthren-17-yl]-2-oxo-ethyl] acetate |
13802 |
[2-[(9R,11S,14S,16S,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydr ocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
27485 |
[1-(9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren -17-yl)-1-oxo-propan-2-yl] acetate |
66257 |
[(2S)-1-[(8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16- octahydrocyclopenta[a]phenanthren-17-yl]-1-oxo-propan-2-yl] acetate |
122054 |
[2-[(8S,9R,10S,13S,14S,16S,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-o ctahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 1865 | Additional Members: 13 | Rows returned: 3 | |
|