| Compound Information | SONAR Target prediction |
| Name: | Terazosin hydrochloride |
| Unique Identifier: | Prest146 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C19ClH26N5O4 |
| Molecular Weight: | 397.687 g/mol |
| X log p: | 4.077 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 75.96 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 9 |
| Rotatable Bond Count: | 5 |
| Canonical Smiles: | Cl.COc1cc2nc(nc(N)c2cc1OC)N1CCN(CC1)C(=O)C1CCCO1 |
| Generic_name: | Terazosin |
| Chemical_iupac_name: | [4-(4-amino-6,7-dimethoxy-quinazolin-2-yl)piperazin-1-yl]-tetrahydrofuran-2-yl-metha none |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA451612 |
| Kegg_compound_id: | C07127 |
| Drugbank_id: | APRD00667 |
| Melting_point: | 273 oC |
| H2o_solubility: | 29.7mg/mL |
| Logp: | 0.875 |
| Cas_registry_number: | 63590-64-7 |
| Drug_category: | Antineoplastic Agents; Adrenergic alpha-Antagonists; Platelet Aggregation Inhibitors; ATC:G04CA03 |
| Indication: | For the treatment of symptomatic benign prostatic hyperplasia (BPH) and also for hypertension. |
| Pharmacology: | Terazosin, classified as a quinazoline, is similar to doxazosin and prazosin. As an alpha-adrenergic blocking agent, terazosin is used to treat hypertension and benign prostatic hypertrophy (BPH). Terazosin produces vasodilation and reduces peripheral resistance but in general has slight effect on cardiac output. Antihypertensive effect with chronic dosing is usually not accompanied by reflex tachycardia. |
| Mechanism_of_action: | Terazosin selectively and competitively inhibits vascular postsynaptic alpha(1)-adrenergic receptors, resulting in peripheral vasodilation and a reduction of vascular resistance and blood pressure. Unlike the nonselective alph-adrenergic blockers phenoxybenzamine and phentolamine, terazosin does not block presynaptic alpha(2)-receptors and, hence, does not cause reflex activation of norepinephrine release to produce reflex tachycardia. |
| Organisms_affected: | Humans and other mammals |
| Found: 3 nonactive as graph: single | with analogs | 1 2 3 Next >> |
| Species: | 9606 |
| Condition: | TMPPre001 |
| Replicates: | 2 |
| Raw OD Value: r im | 1125.0000±0 |
| Normalized OD Score: sc h | 0.9917±0 |
| Z-Score: | -0.1871±0 |
| p-Value: | 0.851592 |
| Z-Factor: | -80.2805 |
| Fitness Defect: | 0.1606 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 9 | 1 2 Next >> |
| 5401 | [4-(4-amino-6,7-dimethoxy-quinazolin-2-yl)piperazin-1-yl]-(oxolan-2-yl)methanone |
| 44383 | [4-(4-amino-6,7-dimethoxy-quinazolin-2-yl)piperazin-1-yl]-(oxolan-2-yl)methanone hydrochloride |
| 63016 | [4-(4-amino-6,7-dimethoxy-quinazolin-2-yl)piperazin-1-yl]-(oxolan-2-yl)methanone dihydrate hydrochloride |
| 663211 | [4-(4-amino-6,7-dimethoxy-quinazolin-2-yl)piperazin-1-yl]-(oxolan-2-yl)methanone; hydrogen(+1) cation; chloride |
| 969465 | [4-(4-amino-6,7-dimethoxy-quinazolin-2-yl)piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone |
| 1398859 | [4-(4-amino-6,7-dimethoxy-quinazolin-2-yl)piperazin-1-yl]-[(2R)-oxolan-2-yl]methanone |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 11747 | Additional Members: 10 | Rows returned: 1 |
| LOPAC 01246 | 0.542553191489362 |
Service provided by the
Mike Tyers Laboratory