| Compound Information | SONAR Target prediction | | Name: | Cortisone | | Unique Identifier: | Prest132 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C21H28O5 | | Molecular Weight: | 335.246 g/mol | | X log p: | -0.717 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 51.21 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC12CCC(=O)C=C1CCC1C3CCC(O)(C(=O)CO)C3(C)CC(=O)C12 |
| Species: |
9606 |
| Condition: |
TMPPre001 |
| Replicates: |
2 |
| Raw OD Value: r im |
2026.0000±0 |
| Normalized OD Score: sc h |
0.9784±0 |
| Z-Score: |
-0.4865±0 |
| p-Value: |
0.62661 |
| Z-Factor: |
-7.89729 |
| Fitness Defect: |
0.4674 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 4|D4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.70 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 1024±959.34887 | | Plate DMSO Control (-): | 2047±547.49039 | | Plate Z-Factor: | -4.6829 |
| png ps pdf |
| 7048651 |
(8S,9R,10S,13R,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydro cyclopenta[a]phenanthrene-3,11-dione |
| 7048652 |
(8S,9R,10R,13R,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydro cyclopenta[a]phenanthrene-3,11-dione |
| 7048653 |
(8R,9R,10S,13R,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydro cyclopenta[a]phenanthrene-3,11-dione |
| 7048654 |
(8R,9R,10R,13R,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydro cyclopenta[a]phenanthrene-3,11-dione |
| 7093535 |
(8S,9R,10R,13S,14R,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydro cyclopenta[a]phenanthrene-3,11-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 11390 | Additional Members: 8 | Rows returned: 6 | |
|