| Compound Information | SONAR Target prediction | | Name: | Ticarcillin sodium | | Unique Identifier: | Prest1305 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H14N2Na2O6S2 | | Molecular Weight: | 416.298 g/mol | | X log p: | 4.471 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 168.24 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | [Na+].[Na+].[O-]C(=O)C1N2C(SC1(C)C)C(NC(=O)C(C([O-])=O)c1cscc1)C2=O |
| Species: |
9606 |
| Condition: |
TMPPre002 |
| Replicates: |
2 |
| Raw OD Value: r im |
6557.0000±0 |
| Normalized OD Score: sc h |
1.1619±0 |
| Z-Score: |
3.6491±0 |
| p-Value: |
0.000263162 |
| Z-Factor: |
-3.58998 |
| Fitness Defect: |
8.2427 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 14|C8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.60 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 666±537.71391 | | Plate DMSO Control (-): | 769.5±270.43450 | | Plate Z-Factor: | -41.4809 |
| png ps pdf |
| 5471 |
6-[(2-carboxy-2-thiophen-3-yl-acetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbo xylic acid |
| 20823 |
disodium 6-[(2-carboxylato-2-thiophen-3-yl-acetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylate |
| 36921 |
(2S,5R,6R)-6-[[(2R)-2-carboxy-2-thiophen-3-yl-acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0 ]heptane-2-carboxylic acid |
| 104961 |
(2S,5R,6R)-6-[(2-carboxy-2-thiophen-3-yl-acetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept ane-2-carboxylic acid |
| 161632 |
disodium (2R,5R,6R)-6-[(2-carboxylato-2-thiophen-3-yl-acetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0] heptane-2-carboxylate |
| 161633 |
(2R,5R,6R)-6-[(2-carboxy-2-thiophen-3-yl-acetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept ane-2-carboxylic acid |
| internal high similarity DBLink | Rows returned: 0 | |
|