| Compound Information | SONAR Target prediction | | Name: | Talampicillin hydrochloride | | Unique Identifier: | Prest1304 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C24ClH24N3O6S | | Molecular Weight: | 495.808 g/mol | | X log p: | 16.887 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 115.28 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 9 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | Cl.CC1(C)SC2C(NC(=O)C(N)c3ccccc3)C(=O)N2C1C(=O)OC1OC(=O)c2ccccc12 |
| Species: |
9606 |
| Condition: |
TMPPre002 |
| Replicates: |
2 |
| Raw OD Value: r im |
5933.5000±0 |
| Normalized OD Score: sc h |
0.8158±0 |
| Z-Score: |
-4.1524±0 |
| p-Value: |
0.000032899 |
| Z-Factor: |
-3.73076 |
| Fitness Defect: |
10.3221 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 13|E11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.50 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 727.5±605.08760 | | Plate DMSO Control (-): | 773±261.27974 | | Plate Z-Factor: | -83.4256 |
| png ps pdf |
| DBLink | Rows returned: 6 | |
| 5373 |
(3-oxo-1H-isobenzofuran-1-yl) 6-[(2-amino-2-phenyl-acetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| 39480 |
(3-oxo-1H-isobenzofuran-1-yl) (5R,6R)-6-[(2-amino-2-phenyl-acetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbox ylate |
| 71446 |
(3-oxo-1H-isobenzofuran-1-yl) (2S,5R,6R)-6-[[(2R)-2-amino-2-phenyl-acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane- 2-carboxylate hydrochloride |
| 71447 |
(3-oxo-1H-isobenzofuran-1-yl) (2S,5R,6R)-6-[[(2R)-2-amino-2-phenyl-acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane- 2-carboxylate |
| 6604402 |
[(1R)-3-oxo-1H-isobenzofuran-1-yl] (2S,5R,6R)-6-[[(2S)-2-amino-2-phenyl-acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane- 2-carboxylate |
| 11979863 |
(3-oxo-1H-isobenzofuran-1-yl) (2R,5R,6S)-6-[(2-amino-2-phenyl-acetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-car boxylate |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 15024 | Additional Members: 10 | Rows returned: 2 | |
|