| Compound Information | SONAR Target prediction | | Name: | Rimexolone | | Unique Identifier: | Prest1297 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C24H34O3 | | Molecular Weight: | 339.279 g/mol | | X log p: | 4.786 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 34.14 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CCC(=O)C1(C)C(C)CC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC21C | | Generic_name: | Rimexolone | | Chemical_iupac_name: | 11-hydroxy-10,13,16,17-tetramethyl-17-propanoyl-7,8,9,11,12,14,15,16-octahydro-6H-cy clopenta[a]phenanthren-3-one | | Drug_type: | Approved Drug | | Pharmgkb_id: | PA451254 | | Drugbank_id: | APRD01220 | | H2o_solubility: | Insoluble | | Logp: | 4.498 | | Cas_registry_number: | 49697-38-3 | | Drug_category: | Anti-inflammatory agents; Corticosteroids; ATC:H02AB12; ATC:S01BA13 | | Indication: | For the treatment of postoperative inflammation following ocular surgery and in the treatment of anterior uveitis. | | Pharmacology: | Rimexolone is a glucocorticoid corticosteroid for systemic use. Corticosteroids suppress the inflammatory response to a variety of inciting agents of a mechanical, chemical, or immunological nature. They inhibit edema, cellular infiltration, capillary dilatation, fibroblastic proliferation, deposition of collagen and scar formation associated with inflammation. | | Mechanism_of_action: | Betamethasone is a glucocorticoid receptor agonist. The antiinflammatory actions of corticosteroids are thought to involve lipocortins, phospholipase A2 inhibitory proteins which, through inhibition of arachidonic acid, control the biosynthesis of prostaglandins and leukotrienes. | | Organisms_affected: | Humans and other mammals |
| Species: |
9606 |
| Condition: |
TMPPre003 |
| Replicates: |
2 |
| Raw OD Value: r im |
10914.0000±0 |
| Normalized OD Score: sc h |
0.9416±0 |
| Z-Score: |
-1.6236±0 |
| p-Value: |
0.104451 |
| Z-Factor: |
-4.81628 |
| Fitness Defect: |
2.259 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 13|F11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.50 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 22091.5±7532.35178 | | Plate DMSO Control (-): | 12139.5±7461.51552 | | Plate Z-Factor: | -5.4357 |
| png ps pdf |
| 6604405 |
(8S,9S,11R,13R,14R,16R,17S)-11-hydroxy-10,13,16,17-tetramethyl-17-propanoyl-7,8,9,11,12,14,15,16-octahyd ro-6H-cyclopenta[a]phenanthren-3-one |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 17014 | Additional Members: 17 | Rows returned: 2 | |
|