| Compound Information | SONAR Target prediction | | Name: | Nomegestrol acetate | | Unique Identifier: | Prest1265 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C23H30O4 | | Molecular Weight: | 344.275 g/mol | | X log p: | 3.437 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 60.44 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CC(=O)OC1(CCC2C3C=C(C)C4=CC(=O)CCC4C3CCC21C)C(C)=O |
| Species: |
9606 |
| Condition: |
TMPPre003 |
| Replicates: |
2 |
| Raw OD Value: r im |
10622.0000±0 |
| Normalized OD Score: sc h |
0.9066±0 |
| Z-Score: |
-2.5985±0 |
| p-Value: |
0.00936398 |
| Z-Factor: |
-4.23741 |
| Fitness Defect: |
4.6709 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 13|H4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.50 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 22091.5±7532.35178 | | Plate DMSO Control (-): | 12139.5±7461.51552 | | Plate Z-Factor: | -5.4357 |
|  png
ps
pdf |
| 4048 |
(17-acetyl-6,10,13-trimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl)
acetate |
| 11683 |
[(8R,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[
a]phenanthren-17-yl] acetate |
| 91668 |
[(8R,9R,10R,13S,14S,17R)-17-acetyl-6,13-dimethyl-3-oxo-1,2,8,9,10,11,12,14,15,16-decahydrocyclopenta[a]p
henanthren-17-yl] acetate |
| 200136 |
[(8R,9S,10R,13S,14S,17R)-17-acetyl-10,13-dimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]p
henanthren-17-yl] acetate |
| 626483 |
(17-acetyl-6,10,13,16-tetramethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl
) acetate |
| 3839280 |
(17-acetyl-10,13-dimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl)
acetate |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 18089 | Additional Members: 2 | Rows returned: 1 | |
|
