Compound Information | SONAR Target prediction | Name: | Nifurtimox | Unique Identifier: | Prest1264 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10H13N3O5S | Molecular Weight: | 274.19 g/mol | X log p: | 6.052 (online calculus) | Lipinksi Failures | 1 | TPSA | 110.49 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 3 | Canonical Smiles: | [O-][N+](=O)c1oc(cc1)C=NN1CCS(=O)(=O)CC1C |
Species: |
9606 |
Condition: |
TMPPre002 |
Replicates: |
2 |
Raw OD Value: r im |
6288.5000±0 |
Normalized OD Score: sc h |
0.9684±0 |
Z-Score: |
-0.7125±0 |
p-Value: |
0.47618 |
Z-Factor: |
-15.4261 |
Fitness Defect: |
0.742 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 13|G5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.50 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 727.5±605.08760 | Plate DMSO Control (-): | 773±261.27974 | Plate Z-Factor: | -83.4256 |
| png ps pdf |
DBLink | Rows returned: 4 | |
31772 |
N-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1-(5-nitro-2-furyl)methanimine |
6178305 |
N-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1-(5-nitro-2-furyl)methanimine |
6604371 |
N-[(3S)-3-methyl-1,1-dioxo-1,4-thiazinan-4-yl]-1-(5-nitro-2-furyl)methanimine |
6842999 |
N-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1-(5-nitro-2-furyl)methanimine |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 14486 | Additional Members: 6 | Rows returned: 2 | |
|