| Compound Information | SONAR Target prediction |
| Name: | Metyrapone |
| Unique Identifier: | Prest1255 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C14H14N2O |
| Molecular Weight: | 212.163 g/mol |
| X log p: | 15.431 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 41.79 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 3 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | CC(C)(c1cccnc1)C(=O)c1cccnc1 |
| Generic_name: | Metyrapone |
| Chemical_iupac_name: | 2-methyl-1,2-dipyridin-3-yl-propan-1-one |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA450486 |
| Kegg_compound_id: | C07205 |
| Drugbank_id: | APRD01111 |
| Melting_point: | 50.5 oC |
| H2o_solubility: | Sparingly soluble |
| Logp: | 2.303 |
| Cas_registry_number: | 54-36-4 |
| Drug_category: | Antimetabolites; Enzyme Inhibitors; ATC:V04CD01 |
| Indication: | Used as a diagnostic drug for testing hypothalamic-pituitary ACTH function. |
| Pharmacology: | Metopirone is an inhibitor of endogenous adrenal corticosteroid synthesis. |
| Mechanism_of_action: | The pharmacological effect of Metopirone is to reduce cortisol and corticosterone production by inhibiting the 11-ß-hydroxylation reaction in the adrenal cortex. Removal of the strong inhibitory feedback mechanism exerted by cortisol results in an increase in adrenocorticotropic hormone (ACTH) production by the pituitary. With continued blockade of the enzymatic steps leading to production of cortisol and corticosterone, there is a marked increase in adrenocortical secretion of their immediate precursors, 11-desoxycortisol and desoxycorticosterone, which are weak suppressors of ACTH release, and a corresponding elevation of these steroids in the plasma and of their metabolites in the urine. These metabolites are readily determined by measuring urinary 17-hydroxycorticosteroids (17-OHCS) or 17-ketogenic steroids (17-KGS). Because of these actions, metopirone is used as a diagnostic test, with urinary 17-OHCS measured as an index of pituitary ACTH responsiveness. Metopirone may also suppress biosynthesis of aldosterone, resulting in a mild natriuresis. |
| Organisms_affected: | Humans and other mammals |