Compound Information | SONAR Target prediction | Name: | Methyldopate hydrochloride | Unique Identifier: | Prest1254 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C12ClH18NO4 | Molecular Weight: | 257.585 g/mol | X log p: | 4.968 (online calculus) | Lipinksi Failures | 0 | TPSA | 35.53 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 5 | Canonical Smiles: | Cl.COc1ccc(CC(C)(N)C(O)=O)cc1OC |
Species: |
9606 |
Condition: |
TMPPre003 |
Replicates: |
2 |
Raw OD Value: r im |
12342.0000±0 |
Normalized OD Score: sc h |
1.0240±0 |
Z-Score: |
0.6691±0 |
p-Value: |
0.503454 |
Z-Factor: |
-6.85932 |
Fitness Defect: |
0.6863 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 13|H9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.50 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 22091.5±7532.35178 | Plate DMSO Control (-): | 12139.5±7461.51552 | Plate Z-Factor: | -5.4357 |
| png ps pdf |
6926458 |
(2S)-2-azaniumyl-3-(3,4-dimethoxyphenyl)-2-methyl-propanoate |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 10977 | Additional Members: 9 | Rows returned: 4 | |
|