| 
 | Compound Information | SONAR Target prediction |  | Name: | Fluticasone propionate |  | Unique Identifier: | Prest1226 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C25F3H31O5S |  | Molecular Weight: | 471.342 g/mol |  | X log p: | 5.725  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 85.74 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 6 |  | Canonical Smiles: | CCC(=O)OC1(C(C)CC2C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC21C)C(=O)SCF |  | Generic_name: | Fluticasone Propionate |  | Chemical_iupac_name: | [6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trimethyl-3-oxo- 6,7,8,9,10,11,12,13,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]propanoate
 |  | Drug_type: | Approved Drug |  | Pharmgkb_id: | PA449687 |  | Kegg_compound_id: | C13171 |  | Drugbank_id: | APRD00065 |  | Melting_point: | 272-273 oC |  | H2o_solubility: | 0.51 mg/L (insoluble) |  | Logp: | 4.068 |  | Cas_registry_number: | 80474-14-2 |  | Drug_category: | Anti-allergic Agents; Dermatologic Agents; Bronchodilator Agents; Anti-inflammatory Agents; Adrenergic Agents; ATC:D07AC17; ATC:R01AD08; ATC:R03BA05
 |  | Indication: | For the maintenance treatment of asthma as prophylactic therapy and for patients requiring oral corticosteroid therapy for asthma.
 |  | Pharmacology: | Fluticasone Propionate, a medium-potency synthetic corticosteroid, is used topically to relieve inflammatory and pruritic symptoms of dermatoses and psoriasis,
 intranasally to manage symptoms of allergic and non-allergic rhinitis, and orally
 for the treatment of asthma.
 |  | Mechanism_of_action: | Binds to the glucocorticoid receptor. Unbound corticosteroids cross the membranes of cells such as mast cells and eosinophils, binding with high affinity to
 glucocorticoid receptors (GR). The results include alteration of transcription and
 protein synthesis, a decreased release of leukocytic acid hydrolases, reduction in
 fibroblast proliferation, prevention of macrophage accumulation at inflamed sites,
 reduction of collagen deposition, interference with leukocyte adhesion to the
 capillary wall, reduction of capillary membrane permeability and subsequent edema,
 reduction of complement components, inhibition of histamine and kinin release, and
 interference with the formation of scar tissue. In the management of asthma, the
 glucocorticoid receptor complexes down-regulates proinflammatory mediators such as
 interleukin-(IL)-1, 3, and 5, and up-regulates anti-inflammatory mediators such as
 IkappaB [inhibitory molecule for nuclear factor kappaB1], IL-10, and IL-12. The
 antiinflammatory actions of corticosteroids are also thought to involve release of
 cytosolic phospholipase A2 which controls the biosynthesis of potent mediators of
 inflammation such as prostaglandins and leukotrienes.
 |  | Organisms_affected: | Humans and other mammals | 
 
 
	
		| Species: | 9606 |  
		| Condition: | TMPPre002 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 6680.0000±0 |  
		| Normalized OD Score: sc h | 1.1399±0 |  
		| Z-Score: | 3.1541±0 |  
		| p-Value: | 0.00160975 |  
		| Z-Factor: | -8.23433 |  
		| Fitness Defect: | 6.4317 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Prestwick |  | Plate Number and Position: | 13|D8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 0 nm |  | Robot Temperature: | 23.50 Celcius |  | Date: | 2006-10-10 YYYY-MM-DD |  | Plate CH Control (+): | 727.5±605.08760 |  | Plate DMSO Control (-): | 773±261.27974 |  | Plate Z-Factor: | -83.4256 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 5 |  | 
 
	
		| 3399 | [6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16 -octahydrocyclopenta[a]phenanthren-17-yl] propanoate
 |  
		| 54580 | [(6S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trim ethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate
 |  
		| 444036 | [(6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-t rimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate
 |  
		| 3081277 | [(6S,8S,10S,11S,13S,14S,16R)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trimethy l-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate
 |  
		| 6604441 | [(6R,8S,9S,10R,11S,13R,14S,16S,17S)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-t rimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate
 |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | active | Cluster 2095 | Additional Members: 14 | Rows returned: 0 |  | 
 
 |