| Compound Information | SONAR Target prediction |
| Name: | Fluticasone propionate |
| Unique Identifier: | Prest1226 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C25F3H31O5S |
| Molecular Weight: | 471.342 g/mol |
| X log p: | 5.725 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 85.74 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 6 |
| Canonical Smiles: | CCC(=O)OC1(C(C)CC2C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC21C)C(=O)SCF |
| Generic_name: | Fluticasone Propionate |
| Chemical_iupac_name: | [6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trimethyl-3-oxo- 6,7,8,9,10,11,12,13,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]propanoate |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA449687 |
| Kegg_compound_id: | C13171 |
| Drugbank_id: | APRD00065 |
| Melting_point: | 272-273 oC |
| H2o_solubility: | 0.51 mg/L (insoluble) |
| Logp: | 4.068 |
| Cas_registry_number: | 80474-14-2 |
| Drug_category: | Anti-allergic Agents; Dermatologic Agents; Bronchodilator Agents; Anti-inflammatory Agents; Adrenergic Agents; ATC:D07AC17; ATC:R01AD08; ATC:R03BA05 |
| Indication: | For the maintenance treatment of asthma as prophylactic therapy and for patients requiring oral corticosteroid therapy for asthma. |
| Pharmacology: | Fluticasone Propionate, a medium-potency synthetic corticosteroid, is used topically to relieve inflammatory and pruritic symptoms of dermatoses and psoriasis, intranasally to manage symptoms of allergic and non-allergic rhinitis, and orally for the treatment of asthma. |
| Mechanism_of_action: | Binds to the glucocorticoid receptor. Unbound corticosteroids cross the membranes of cells such as mast cells and eosinophils, binding with high affinity to glucocorticoid receptors (GR). The results include alteration of transcription and protein synthesis, a decreased release of leukocytic acid hydrolases, reduction in fibroblast proliferation, prevention of macrophage accumulation at inflamed sites, reduction of collagen deposition, interference with leukocyte adhesion to the capillary wall, reduction of capillary membrane permeability and subsequent edema, reduction of complement components, inhibition of histamine and kinin release, and interference with the formation of scar tissue. In the management of asthma, the glucocorticoid receptor complexes down-regulates proinflammatory mediators such as interleukin-(IL)-1, 3, and 5, and up-regulates anti-inflammatory mediators such as IkappaB [inhibitory molecule for nuclear factor kappaB1], IL-10, and IL-12. The antiinflammatory actions of corticosteroids are also thought to involve release of cytosolic phospholipase A2 which controls the biosynthesis of potent mediators of inflammation such as prostaglandins and leukotrienes. |
| Organisms_affected: | Humans and other mammals |
| Found: 3 nonactive as graph: single | with analogs | << Back 1 2 3 Next >> |
| Species: | 9606 |
| Condition: | TMPPre002 |
| Replicates: | 2 |
| Raw OD Value: r im | 6680.0000±0 |
| Normalized OD Score: sc h | 1.1399±0 |
| Z-Score: | 3.1541±0 |
| p-Value: | 0.00160975 |
| Z-Factor: | -8.23433 |
| Fitness Defect: | 6.4317 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 5 |
| 3399 | [6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16 -octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
| 54580 | [(6S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trim ethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
| 444036 | [(6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-t rimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
| 3081277 | [(6S,8S,10S,11S,13S,14S,16R)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trimethy l-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
| 6604441 | [(6R,8S,9S,10R,11S,13R,14S,16S,17S)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-t rimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 2095 | Additional Members: 14 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory