| Compound Information | SONAR Target prediction | | Name: | Luteolin | | Unique Identifier: | Prest122 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H10O6 | | Molecular Weight: | 276.157 g/mol | | X log p: | 13.108 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1cc(O)c2C(=O)C=C(Oc2c1)c1ccc(O)c(O)c1 |
| Species: |
9606 |
| Condition: |
TMPPre001 |
| Replicates: |
2 |
| Raw OD Value: r im |
499.0000±0 |
| Normalized OD Score: sc h |
0.7178±0 |
| Z-Score: |
-6.3612±0 |
| p-Value: |
0.000000000200156 |
| Z-Factor: |
-2.19952 |
| Fitness Defect: |
22.3319 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 11|G11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.20 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 853.5±701.09504 | | Plate DMSO Control (-): | 849±311.18603 | | Plate Z-Factor: | -72.3031 |
| png ps pdf |
| DBLink | Rows returned: 2 | |
| 5280445 |
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chromen-4-one |
| 5281701 |
5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 0 | |
|