Compound Information | SONAR Target prediction | Name: | Cyproterone acetate | Unique Identifier: | Prest1208 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C24ClH29O4 | Molecular Weight: | 390.731 g/mol | X log p: | 3.24 (online calculus) | Lipinksi Failures | 0 | TPSA | 60.44 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC(=O)OC1(CCC2C3C=C(Cl)C4=CC(=O)C5CC5C4(C)C3CCC21C)C(C)=O |
Species: |
9606 |
Condition: |
TMPPre002 |
Replicates: |
2 |
Raw OD Value: r im |
4509.0000±0 |
Normalized OD Score: sc h |
0.7248±0 |
Z-Score: |
-6.2040±0 |
p-Value: |
0.000000000550312 |
Z-Factor: |
-4.08267 |
Fitness Defect: |
21.3205 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 14|D5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.60 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 666±537.71391 | Plate DMSO Control (-): | 769.5±270.43450 | Plate Z-Factor: | -41.4809 |
| png ps pdf |
2714 |
(17-acetyl-6-chloro-10,13-dimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-y l) acetate |
2914 |
n/a |
9324 |
[(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclo penta[a]phenanthren-17-yl] acetate |
9875 |
[(9S,14S,16R,17R)-17-acetyl-6-chloro-10,13,16-trimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopen ta[a]phenanthren-17-yl] acetate |
9880 |
n/a |
31125 |
[(17R)-17-acetyl-6-chloro-13-methyl-3-oxo-1,2,8,9,10,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17 -yl] acetate |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 5652 | Additional Members: 7 | Rows returned: 6 | |
|