Compound Information | SONAR Target prediction | Name: | Alfaxalone | Unique Identifier: | Prest1190 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C21H32O3 | Molecular Weight: | 304.255 g/mol | X log p: | -0.808 (online calculus) | Lipinksi Failures | 0 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(=O)C1CCC2C3CCC4CC(O)CCC4(C)C3C(=O)CC21C |
Species: |
9606 |
Condition: |
TMPPre002 |
Replicates: |
2 |
Raw OD Value: r im |
6710.5000±0 |
Normalized OD Score: sc h |
1.1073±0 |
Z-Score: |
2.4179±0 |
p-Value: |
0.0156091 |
Z-Factor: |
-12.1438 |
Fitness Defect: |
4.1599 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 13|E3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.50 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 727.5±605.08760 | Plate DMSO Control (-): | 773±261.27974 | Plate Z-Factor: | -83.4256 |
| png ps pdf |
7002436 |
(3S,5S,8R,9R,10S,13R,14S,17R)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetrad ecahydrocyclopenta[a]phenanthren-11-one |
7002437 |
(3S,5S,8R,9R,10S,13R,14R,17R)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetrad ecahydrocyclopenta[a]phenanthren-11-one |
7002438 |
(3S,5S,8R,9S,10S,13R,14R,17R)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetrad ecahydrocyclopenta[a]phenanthren-11-one |
7056778 |
(3R,5R,8S,9R,10S,13R,14S,17R)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetrad ecahydrocyclopenta[a]phenanthren-11-one |
7056779 |
(3R,5R,8S,9R,10S,13R,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetrad ecahydrocyclopenta[a]phenanthren-11-one |
7056780 |
(3R,5R,8S,9R,10S,13R,14R,17R)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetrad ecahydrocyclopenta[a]phenanthren-11-one |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 7027 | Additional Members: 5 | Rows returned: 0 | |
|