| Compound Information | SONAR Target prediction | | Name: | Adrenosterone | | Unique Identifier: | Prest1155 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C19H24O3 | | Molecular Weight: | 279.225 g/mol | | X log p: | -0.0529999999999999 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 51.21 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC12CC(=O)C3C(CCC4=CC(=O)CCC34C)C1CCC2=O |
| Species: |
9606 |
| Condition: |
TMPPre001 |
| Replicates: |
2 |
| Raw OD Value: r im |
781.0000±0 |
| Normalized OD Score: sc h |
0.8604±0 |
| Z-Score: |
-3.1472±0 |
| p-Value: |
0.00164864 |
| Z-Factor: |
-5.77605 |
| Fitness Defect: |
6.4078 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 12|B10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.30 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 758.5±653.58671 | | Plate DMSO Control (-): | 822.5±277.54018 | | Plate Z-Factor: | -66.6597 |
| png ps pdf |
| 9791 |
10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11,17-trione |
| 151425 |
(8S,9S,10R,13S,14S)-13-methyl-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,11,17-tr ione |
| 223997 |
(8S,9S,10R,13S,14S)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11,17-tr ione |
| 227844 |
(5S,8S,9S,10S,13S,14S)-10,13-dimethyl-4,5,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11,17 -trione |
| 522491 |
10,13-dimethyl-4,5,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11,17-trione |
| 558225 |
1,2-dimethyl-4-oxo-6-propan-2-yl-bicyclo[3.3.1]non-2-ene-9-carbaldehyde |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 11390 | Additional Members: 8 | Rows returned: 6 | |
|