| Compound Information | SONAR Target prediction | | Name: | (-)-Adenosine 3`,5`-cyclic monophosphate | | Unique Identifier: | Prest1144 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C10H12N5O6P | | Molecular Weight: | 317.111 g/mol | | X log p: | 1.654 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 94.89 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 11 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Nc1ncnc2n(cnc12)C1OC2COP(O)(=O)OC2C1O | | Generic_name: | CYCLIC AMP; CAMP | | Chemical_iupac_name: | ADENOSINE-3-,5--CYCLIC-MONOPHOSPHATE | | Drug_type: | Experimental | | Drugbank_id: | EXPT00959 | | Logp: | -0.53 +/- 0.57 | | Drug_category: | Adenylate Cyclase inhibitor | | Organisms_affected: | -1 |
| Species: |
9606 |
| Condition: |
TMPPre001 |
| Replicates: |
2 |
| Raw OD Value: r im |
773.0000±0 |
| Normalized OD Score: sc h |
0.9321±0 |
| Z-Score: |
-1.5311±0 |
| p-Value: |
0.125753 |
| Z-Factor: |
-8959.38 |
| Fitness Defect: |
2.0734 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 14|F3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.60 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 666±537.71391 | | Plate DMSO Control (-): | 769.5±270.43450 | | Plate Z-Factor: | -41.4809 |
| png ps pdf |
| 6603718 |
(1R,6R,8R,9S)-8-(6-aminopurin-9-yl)-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nonan-9-ol |
| 6604194 |
(1S,6S,8R,9S)-8-(6-aminopurin-9-yl)-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nonan-9-ol |
| 6713792 |
(1S,6S,8S,9R)-8-(6-aminopurin-9-yl)-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nonan-9-ol |
| 6714006 |
(1S,6R,8R)-8-(6-aminopurin-9-yl)-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nonan-9-ol |
| 7059571 |
(1R,6R,8R,9R)-8-(6-aminopurin-9-yl)-3-oxido-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nonan-9-ol |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 725 | Additional Members: 3 | Rows returned: 0 | |
|