| Compound Information | SONAR Target prediction | | Name: | Kaempferol | | Unique Identifier: | Prest1133 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H10O6 | | Molecular Weight: | 276.157 g/mol | | X log p: | 13.108 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1ccc(cc1)C1Oc2cc(O)cc(O)c2C(=O)C=1O | | Generic_name: | KAEMPHEROL | | Chemical_iupac_name: | 3,5,7-TRIHYDROXY-2-(4-HYDROXYPHENYL)-4H-CHROMEN-4-ONE | | Drug_type: | Experimental | | Drugbank_id: | EXPT01976 | | Logp: | -0.88 | | Drug_category: | Quercetin 2,3-Dioxygenase inhibitor | | Organisms_affected: | -1 |
| Species: |
9606 |
| Condition: |
TMPPre001 |
| Replicates: |
2 |
| Raw OD Value: r im |
521.0000±0 |
| Normalized OD Score: sc h |
0.7006±0 |
| Z-Score: |
-6.7486±0 |
| p-Value: |
0.0000000000149241 |
| Z-Factor: |
-3.55242 |
| Fitness Defect: |
24.928 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 14|F9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.60 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 666±537.71391 | | Plate DMSO Control (-): | 769.5±270.43450 | | Plate Z-Factor: | -41.4809 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 5280863 |
3,5,7-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 0 | |
|