Compound Information | SONAR Target prediction | Name: | Chrysin | Unique Identifier: | Prest1131 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H10O4 | Molecular Weight: | 244.158 g/mol | X log p: | 16.715 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1cc(O)c2C(=O)C=C(Oc2c1)c1ccccc1 |
Species: |
9606 |
Condition: |
TMPPre003 |
Replicates: |
2 |
Raw OD Value: r im |
11073.0000±0 |
Normalized OD Score: sc h |
0.9198±0 |
Z-Score: |
-2.2301±0 |
p-Value: |
0.025742 |
Z-Factor: |
-3.75541 |
Fitness Defect: |
3.6596 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 12|A10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.30 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 22056±7270.79638 | Plate DMSO Control (-): | 12341.5±7132.64330 | Plate Z-Factor: | -6.0351 |
| png ps pdf |
DBLink | Rows returned: 1 | |
5281607 |
5,7-dihydroxy-2-phenyl-chromen-4-one |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 1884 | Additional Members: 20 | Rows returned: 6 | |
|