| Compound Information | SONAR Target prediction | | Name: | Chrysin | | Unique Identifier: | Prest1131 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H10O4 | | Molecular Weight: | 244.158 g/mol | | X log p: | 16.715 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1cc(O)c2C(=O)C=C(Oc2c1)c1ccccc1 |
| Species: |
9606 |
| Condition: |
TMPPre001 |
| Replicates: |
2 |
| Raw OD Value: r im |
762.0000±0 |
| Normalized OD Score: sc h |
0.8305±0 |
| Z-Score: |
-3.8200±0 |
| p-Value: |
0.000133445 |
| Z-Factor: |
-4.64758 |
| Fitness Defect: |
8.9218 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 12|A10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.30 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 758.5±653.58671 | | Plate DMSO Control (-): | 822.5±277.54018 | | Plate Z-Factor: | -66.6597 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 5281607 |
5,7-dihydroxy-2-phenyl-chromen-4-one |
| internal high similarity DBLink | Rows returned: 0 | |
|
