| Compound Information | SONAR Target prediction |
| Name: | Cefixime |
| Unique Identifier: | Prest1090 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C16H15N5O7S2 |
| Molecular Weight: | 440.349 g/mol |
| X log p: | 1.403 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 156.07 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 10 |
| Rotatable Bond Count: | 9 |
| Canonical Smiles: | Nc1scc(n1)C(=NOCC(O)=O)C(=O)NC1C2SCC(C=C)=C(N2C1=O)C(O)=O |
| Generic_name: | Cefixime |
| Chemical_iupac_name: | 8-[[2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-4-ethenyl-7-ox o-2-thia-6-azabicyclo[4.2.0]oct-4-ene-5-carboxylic acid |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA448844 |
| Kegg_compound_id: | C06881 |
| Drugbank_id: | APRD00583 |
| Melting_point: | 218-225 oC |
| H2o_solubility: | 55.11 mg/L |
| Logp: | -0.559 |
| Cas_registry_number: | 79350-37-1 |
| Drug_category: | Anti-bacterial Agents; Cephalosporins; ATC:J01DD08 |
| Indication: | For use in the treatment of the following infections when caused by susceptible strains of the designated microorganisms:(1) uncomplicated urinary tract infections caused by Escherichia coli and Proteus mirabilis, (2) otitis media caused by Haemophilus influenzae (beta-lactamase positive and negative strains), Moraxella catarrhalis (most of which are beta-lactamase positive), and S. pyogenes, (3) pharyngitis and tonsillitis caused by S. pyogenes, (4) acute bronchitis and acute exacerbations of chronic bronchitis caused by Streptococcus pneumoniae and Haemophilus influenzae (beta-lactamase positive and negative strains), and (5) uncomplicated gonorrhea (cervical/urethral) caused by Neisseria gonorrhoeae (penicillinase- and non-penicillinase-producing strains). |
| Pharmacology: | Cefixime, an antibiotic, is a third-generation cephalosporin like ceftriaxone and cefotaxime. Cefixime is highly stable in the presence of beta-lactamase enzymes. As a result, many organisms resistant to penicillins and some cephalosporins due to the presence of beta-lactamases, may be susceptible to cefixime. The antibacterial effect of cefixime results from inhibition of mucopeptide synthesis in the bacterial cell wall. |
| Mechanism_of_action: | Like all beta-lactam antibiotics, cefixime binds to specific penicillin-binding proteins (PBPs) located inside the bacterial cell wall, causing the inhibition of the third and last stage of bacterial cell wall synthesis. Cell lysis is then mediated by bacterial cell wall autolytic enzymes such as autolysins; it is possible that cefixime interferes with an autolysin inhibitor. |
| Organisms_affected: | Enteric bacteria and other eubacteria |
| Found: 3 nonactive as graph: single | with analogs | 1 2 3 Next >> |
| Species: | 9606 |
| Condition: | TMPPre001 |
| Replicates: | 2 |
| Raw OD Value: r im | 1998.0000±0 |
| Normalized OD Score: sc h | 0.9399±0 |
| Z-Score: | -1.3537±0 |
| p-Value: | 0.175818 |
| Z-Factor: | -32.5467 |
| Fitness Defect: | 1.7383 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 8 | 1 2 Next >> |
| 2675 | 7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicycl o[4.2.0]oct-2-ene-2-carboxylic acid |
| 54362 | (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-a zabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| 5353520 | 7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azab icyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| 5362065 | (6R,7R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thi a-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| 5491577 | (6R,7R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thi a-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid trihydrate |
| 5943039 | 7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azab icyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 437 | Additional Members: 14 | Rows returned: 2 |
| SPE01503111 | 0.340425531914894 |
| SPE01502033 | 0.289156626506024 |
Service provided by the
Mike Tyers Laboratory