| Compound Information | SONAR Target prediction |
| Name: | Furazolidone |
| Unique Identifier: | Prest1067 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C8H7N3O5 |
| Molecular Weight: | 218.103 g/mol |
| X log p: | 6.981 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 94.27 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | [O-][N+](=O)c1oc(cc1)C=NN1CCOC1=O |
| Generic_name: | Furazolidone |
| Chemical_iupac_name: | 3-[(5-nitro-2-furyl)methylideneamino]oxazolidin-2-one |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA449718 |
| Kegg_compound_id: | C07999 |
| Drugbank_id: | APRD00988 |
| Melting_point: | 255 oC |
| H2o_solubility: | 40 mg/L |
| Logp: | 0.691 |
| Cas_registry_number: | 67-45-8 |
| Drug_category: | Anti-Infective Agents, Local; Anti-Infective Agents, Urinary; Antitrichomonal Agents; Monoamine Oxidase Inhibitors; ATC:G01AX06 |
| Indication: | For the specific and symptomatic treatment of bacterial or protozoal diarrhea and enteritis caused by susceptible organisms. |
| Pharmacology: | Furoxone has a broad antibacterial spectrum covering the majority of gastrointestinal tract pathogens including E. coli, staphylococci, Salmonella, Shigella, Proteus, Aerobacter aerogenes, Vibrio cholerae and Giardia lamblia. Its bactericidal activity is based upon its interference with DNA replication and protein production; this antimicrobial action minimizes the development of resistant organisms. |
| Mechanism_of_action: | Furazolidone and its related free radical products are believed to bind DNA and induce cross-links. Bacterial DNA is particularly susceptible to this drug leading to high levels of mutations (transitions and transversions) in the bacterial chromosome. |
| Organisms_affected: | Microbes (bacteria, parasites) |
| Found: 3 active as graph: single | with analogs | 1 2 3 Next >> |
| Species: | 9606 |
| Condition: | TMPPre001 |
| Replicates: | 2 |
| Raw OD Value: r im | 804.0000±0 |
| Normalized OD Score: sc h | 0.8117±0 |
| Z-Score: | -4.2438±0 |
| p-Value: | 0.0000219748 |
| Z-Factor: | -3.40302 |
| Fitness Defect: | 10.7256 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 4 |
| 3435 | 3-[(5-nitro-2-furyl)methylideneamino]oxazolidin-2-one |
| 5323714 | 3-[(5-nitro-2-furyl)methylideneamino]oxazolidin-2-one |
| 5353636 | 3-[(5-nitro-2-furyl)methylideneamino]oxazolidin-2-one |
| 6837169 | hydroxy-oxo-[5-[(2-oxooxazolidin-3-yl)iminomethyl]-2-furyl]azanium |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 4702 | Additional Members: 3 | Rows returned: 1 |
| SPE01500309 | 0 |
Service provided by the
Mike Tyers Laboratory