Compound Information | SONAR Target prediction |
Name: | Fluocinonide |
Unique Identifier: | Prest1066 |
MolClass: | Checkout models in ver1.5 and ver1.0 |
Molecular Formula: | C26F2H32O7 |
Molecular Weight: | 464.287 g/mol |
X log p: | 4.867 (online calculus) |
Lipinksi Failures | 0 |
TPSA | 78.9 |
Hydrogen Bond Donor Count: | 0 |
Hydrogen Bond Acceptors Count: | 7 |
Rotatable Bond Count: | 4 |
Canonical Smiles: | CC(=O)OCC(=O)C12OC(C)(C)OC1CC1C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC12C |
Generic_name: | Fluocinonide |
Drug_type: | Approved Drug |
Pharmgkb_id: | PA449664 |
Kegg_compound_id: | D00325 |
Drugbank_id: | APRD00978 |
Melting_point: | 309 oC |
H2o_solubility: | 4.74 mg/L |
Logp: | 2.734 |
Cas_registry_number: | 12/07/356 |
Drug_category: | Anti-Allergic Agents; Anti-Inflammatory Agents; Glucocorticoids; ATC:C05AA11; ATC:D07AC08 |
Indication: | A topical anti-inflammatory product for the relief of the inflammatory and pruritic manifestations of corticosteroid-responsive dermatoses. |
Organisms_affected: | Humans and other mammals |