| Compound Information | SONAR Target prediction |
| Name: | Fluocinonide |
| Unique Identifier: | Prest1066 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C26F2H32O7 |
| Molecular Weight: | 464.287 g/mol |
| X log p: | 4.867 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 78.9 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 7 |
| Rotatable Bond Count: | 4 |
| Canonical Smiles: | CC(=O)OCC(=O)C12OC(C)(C)OC1CC1C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC12C |
| Generic_name: | Fluocinonide |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA449664 |
| Kegg_compound_id: | D00325 |
| Drugbank_id: | APRD00978 |
| Melting_point: | 309 oC |
| H2o_solubility: | 4.74 mg/L |
| Logp: | 2.734 |
| Cas_registry_number: | 12/07/356 |
| Drug_category: | Anti-Allergic Agents; Anti-Inflammatory Agents; Glucocorticoids; ATC:C05AA11;
ATC:D07AC08 |
| Indication: | A topical anti-inflammatory product for the relief of the inflammatory and pruritic
manifestations of corticosteroid-responsive dermatoses. |
| Organisms_affected: | Humans and other mammals |
