| Compound Information | SONAR Target prediction | | Name: | Theobromine | | Unique Identifier: | Prest1054 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C7H8N4O2 | | Molecular Weight: | 172.101 g/mol | | X log p: | 1.673 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 52.98 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | Cn1cnc2N(C)C(=O)NC(=O)c12 |
| Species: |
9606 |
| Condition: |
TMPPre003 |
| Replicates: |
2 |
| Raw OD Value: r im |
13128.0000±0 |
| Normalized OD Score: sc h |
1.0389±0 |
| Z-Score: |
1.0813±0 |
| p-Value: |
0.279556 |
| Z-Factor: |
-7.84166 |
| Fitness Defect: |
1.2746 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 11|H5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.20 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 21969.5±7626.88802 | | Plate DMSO Control (-): | 12948±7402.41727 | | Plate Z-Factor: | -6.2689 |
| png ps pdf |
| DBLink | Rows returned: 4 | |
| 5429 |
3,7-dimethylpurine-2,6-dione |
| 24700 |
sodium 3,7-dimethylpurine-2,6-dione |
| 205018 |
3,7-dimethylpurine-2,6-dione hydroiodide |
| 3031945 |
lithium 3,7-dimethylpurine-2,6-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 9605 | Additional Members: 8 | Rows returned: 0 | |
|