Compound Information | SONAR Target prediction | Name: | Ethaverine hydrochloride | Unique Identifier: | Prest1049 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C24ClH30NO4 | Molecular Weight: | 401.714 g/mol | X log p: | 15.994 (online calculus) | Lipinksi Failures | 1 | TPSA | 49.28 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 10 | Canonical Smiles: | Cl.CCOc1ccc(Cc2nccc3cc(OCC)c(OCC)cc23)cc1OCC |
Species: |
9606 |
Condition: |
TMPPre003 |
Replicates: |
2 |
Raw OD Value: r im |
9775.0000±0 |
Normalized OD Score: sc h |
0.8549±0 |
Z-Score: |
-4.0374±0 |
p-Value: |
0.0000540558 |
Z-Factor: |
-3.53765 |
Fitness Defect: |
9.8255 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 11|C11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.20 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 21969.5±7626.88802 | Plate DMSO Control (-): | 12948±7402.41727 | Plate Z-Factor: | -6.2689 |
| png ps pdf |
DBLink | Rows returned: 2 | |
3280 |
1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-isoquinoline |
5702159 |
1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-isoquinoline hydrochloride |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 1145 | Additional Members: 7 | Rows returned: 1 | |
|